Products

Product:
Febuxostat
Category:
Intermediate/pharmaceutical intermediate
CAS NO:
144060-53-7
Molecular weight:
316.3748
Molecular formula:

C16H16N2O3S

Alias:
2-[3-Cyano-4-isobutoxyphenyl]-4-methylthiazole-5-carboxylic acid; 2-[3-Cyano-4-(2-methylpropoxy)phenyl]-4-methyl-1,3-thiazole-5-carboxylic acid; 2-[3-cyano-4-(2-methylpropoxy)phenyl]-4-methylthiazole-5-carboxylic acid; Febuxostat (Polymorphs); 2-[3-cyano-4-(2-methylpropoxy)phenyl]-4-methyl-1,3-thiazole-5-carboxylic acid
InChI:
InChI=1/C16H16N2O3S/c1-9(2)8-21-13-5-4-11(6-12(13)7-17)15-18-10(3)14(22-15)16(19)20/h4-6,9H,8H2,1-3H3,(H,19,20)
Structural formula:
Return